C12H10N4O2S — CID 83190548
2-(2-nitrophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83190548) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-(2-nitrophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 83190548 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(2-nitrophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccccc2[N+](=O)[O-])nc2c1CSC2 |
| InChI | InChI=1S/C12H10N4O2S/c13-11-8-5-19-6-9(8)14-12(15-11)7-3-1-2-4-10(7)16(17)18/h1-4H,5-6H2,(H2,13,14,15) |
| InChIKey | BWGMVBZSZNBOOH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|