C13H13N5O3 — CID 106473523
[2-(2-nitrophenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine (PubChem CID 106473523) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine.
| Compound Name | [2-(2-nitrophenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 106473523 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [2-(2-nitrophenyl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1nc(-c2ccccc2[N+](=O)[O-])nc2c1COCC2 |
| InChI | InChI=1S/C13H13N5O3/c14-17-13-9-7-21-6-5-10(9)15-12(16-13)8-3-1-2-4-11(8)18(19)20/h1-4H,5-7,14H2,(H,15,16,17) |
| InChIKey | QVVVOPVIXRJIHU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|