C14H11BrClF2IN2 — CID 107537899
2-(2-bromo-3,4-difluorophenyl)-4-chloro-5-iodo-6-(2-methylpropyl)pyrimidine (PubChem CID 107537899) has the molecular formula C14H11BrClF2IN2 and a molecular weight of 487.51 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-4-chloro-5-iodo-6-(2-methylpropyl)pyrimidine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-4-chloro-5-iodo-6-(2-methylpropyl)pyrimidine |
|---|---|
| PubChem CID | 107537899 |
| Molecular Formula | C14H11BrClF2IN2 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 485.88 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-4-chloro-5-iodo-6-(2-methylpropyl)pyrimidine |
| SMILES | CC(C)Cc1nc(-c2ccc(F)c(F)c2Br)nc(Cl)c1I |
| InChI | InChI=1S/C14H11BrClF2IN2/c1-6(2)5-9-12(19)13(16)21-14(20-9)7-3-4-8(17)11(18)10(7)15/h3-4,6H,5H2,1-2H3 |
| InChIKey | UMFJWWUGBUFVQC-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|