C13H10BrF2N3O — CID 107541448
4-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutanenitrile (PubChem CID 107541448) has the molecular formula C13H10BrF2N3O and a molecular weight of 342.14 g/mol. Its IUPAC name is 4-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutanenitrile.
| Compound Name | 4-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 107541448 |
| Molecular Formula | C13H10BrF2N3O |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 4-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-3-methylbutanenitrile |
| SMILES | CC(CC#N)Cc1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C13H10BrF2N3O/c1-7(4-5-17)6-10-18-13(19-20-10)8-2-3-9(15)12(16)11(8)14/h2-3,7H,4,6H2,1H3 |
| InChIKey | PRIDDJKAQDQCSQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|