C13H14BrF2N3O — CID 107537171
N-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]butan-2-amine (PubChem CID 107537171) has the molecular formula C13H14BrF2N3O and a molecular weight of 346.18 g/mol. Its IUPAC name is N-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]butan-2-amine.
| Compound Name | N-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 107537171 |
| Molecular Formula | C13H14BrF2N3O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | N-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]butan-2-amine |
| SMILES | CCC(C)NCc1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C13H14BrF2N3O/c1-3-7(2)17-6-10-18-13(19-20-10)8-4-5-9(15)12(16)11(8)14/h4-5,7,17H,3,6H2,1-2H3 |
| InChIKey | YKWHHJYORCNAPQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|