C10H8BrF2N3O — CID 107537161
2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine (PubChem CID 107537161) has the molecular formula C10H8BrF2N3O and a molecular weight of 304.09 g/mol. Its IUPAC name is 2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine.
| Compound Name | 2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 107537161 |
| Molecular Formula | C10H8BrF2N3O |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine |
| SMILES | NCCc1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C10H8BrF2N3O/c11-8-5(1-2-6(12)9(8)13)10-15-7(3-4-14)17-16-10/h1-2H,3-4,14H2 |
| InChIKey | MOLQFIYNDLFSEO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|