C13H12BrF2N3O — CID 107537313
3-(2-bromo-3,4-difluorophenyl)-5-(pyrrolidin-2-ylmethyl)-1,2,4-oxadiazole (PubChem CID 107537313) has the molecular formula C13H12BrF2N3O and a molecular weight of 344.16 g/mol. Its IUPAC name is 3-(2-bromo-3,4-difluorophenyl)-5-(pyrrolidin-2-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(2-bromo-3,4-difluorophenyl)-5-(pyrrolidin-2-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107537313 |
| Molecular Formula | C13H12BrF2N3O |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 3-(2-bromo-3,4-difluorophenyl)-5-(pyrrolidin-2-ylmethyl)-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2noc(CC3CCCN3)n2)c(Br)c1F |
| InChI | InChI=1S/C13H12BrF2N3O/c14-11-8(3-4-9(15)12(11)16)13-18-10(20-19-13)6-7-2-1-5-17-7/h3-4,7,17H,1-2,5-6H2 |
| InChIKey | YTSHFPXMSSWFIP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|