C14H13BrF2N2O2 — CID 107541022
2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol (PubChem CID 107541022) has the molecular formula C14H13BrF2N2O2 and a molecular weight of 359.17 g/mol. Its IUPAC name is 2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol.
| Compound Name | 2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 107541022 |
| Molecular Formula | C14H13BrF2N2O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 2-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1c1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C14H13BrF2N2O2/c15-11-8(5-6-9(16)12(11)17)13-18-14(21-19-13)7-3-1-2-4-10(7)20/h5-7,10,20H,1-4H2 |
| InChIKey | ZZZXFQZTKKELFL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|