C11H10BrF2N3O — CID 107539888
3-(2-bromo-3,4-difluorophenyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine (PubChem CID 107539888) has the molecular formula C11H10BrF2N3O and a molecular weight of 318.12 g/mol. Its IUPAC name is 3-(2-bromo-3,4-difluorophenyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(2-bromo-3,4-difluorophenyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 107539888 |
| Molecular Formula | C11H10BrF2N3O |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 3-(2-bromo-3,4-difluorophenyl)-N-propan-2-yl-1,2,4-oxadiazol-5-amine |
| SMILES | CC(C)Nc1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C11H10BrF2N3O/c1-5(2)15-11-16-10(17-18-11)6-3-4-7(13)9(14)8(6)12/h3-5H,1-2H3,(H,15,16,17) |
| InChIKey | JPFJXCUQTJHOSM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|