C14H10BrF2N3O — CID 107541449
3-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropane-1-carbonitrile (PubChem CID 107541449) has the molecular formula C14H10BrF2N3O and a molecular weight of 354.15 g/mol. Its IUPAC name is 3-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropane-1-carbonitrile.
| Compound Name | 3-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 107541449 |
| Molecular Formula | C14H10BrF2N3O |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 3-[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]-2,2-dimethylcyclopropane-1-carbonitrile |
| SMILES | CC1(C)C(C#N)C1c1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C14H10BrF2N3O/c1-14(2)7(5-18)9(14)13-19-12(20-21-13)6-3-4-8(16)11(17)10(6)15/h3-4,7,9H,1-2H3 |
| InChIKey | CGQRVLVPOLWQGP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|