C12H10BrF2N3O — CID 107537229
5-(azetidin-3-ylmethyl)-3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazole (PubChem CID 107537229) has the molecular formula C12H10BrF2N3O and a molecular weight of 330.13 g/mol. Its IUPAC name is 5-(azetidin-3-ylmethyl)-3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(azetidin-3-ylmethyl)-3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 107537229 |
| Molecular Formula | C12H10BrF2N3O |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 5-(azetidin-3-ylmethyl)-3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1ccc(-c2noc(CC3CNC3)n2)c(Br)c1F |
| InChI | InChI=1S/C12H10BrF2N3O/c13-10-7(1-2-8(14)11(10)15)12-17-9(19-18-12)3-6-4-16-5-6/h1-2,6,16H,3-5H2 |
| InChIKey | IGXPECXUZDXLIH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|