C11H7BrF2N2O3S — CID 107537425
2-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid (PubChem CID 107537425) has the molecular formula C11H7BrF2N2O3S and a molecular weight of 365.16 g/mol. Its IUPAC name is 2-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 107537425 |
| Molecular Formula | C11H7BrF2N2O3S |
| Molecular Weight | 365.16 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 2-[[3-(2-bromo-3,4-difluorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1nc(-c2ccc(F)c(F)c2Br)no1 |
| InChI | InChI=1S/C11H7BrF2N2O3S/c12-9-5(1-2-6(13)10(9)14)11-15-7(19-16-11)3-20-4-8(17)18/h1-2H,3-4H2,(H,17,18) |
| InChIKey | XBGCTGKCBFGKSR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|