C12H10Br2ClIN2S — CID 102842723
4-chloro-2-(4,5-dibromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine (PubChem CID 102842723) has the molecular formula C12H10Br2ClIN2S and a molecular weight of 536.46 g/mol. Its IUPAC name is 4-chloro-2-(4,5-dibromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine.
| Compound Name | 4-chloro-2-(4,5-dibromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine |
|---|---|
| PubChem CID | 102842723 |
| Molecular Formula | C12H10Br2ClIN2S |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 533.77 |
| IUPAC Name | 4-chloro-2-(4,5-dibromothiophen-2-yl)-5-iodo-6-(2-methylpropyl)pyrimidine |
| SMILES | CC(C)Cc1nc(-c2cc(Br)c(Br)s2)nc(Cl)c1I |
| InChI | InChI=1S/C12H10Br2ClIN2S/c1-5(2)3-7-9(16)11(15)18-12(17-7)8-4-6(13)10(14)19-8/h4-5H,3H2,1-2H3 |
| InChIKey | HZINKTLWYXVNTM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|