C14H8BrClF2N2S — CID 107532954
2-(2-bromo-3,4-difluorophenyl)-4-chloro-6-ethylthieno[2,3-d]pyrimidine (PubChem CID 107532954) has the molecular formula C14H8BrClF2N2S and a molecular weight of 389.65 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-4-chloro-6-ethylthieno[2,3-d]pyrimidine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-4-chloro-6-ethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 107532954 |
| Molecular Formula | C14H8BrClF2N2S |
| Molecular Weight | 389.65 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-4-chloro-6-ethylthieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(Cl)nc(-c3ccc(F)c(F)c3Br)nc2s1 |
| InChI | InChI=1S/C14H8BrClF2N2S/c1-2-6-5-8-12(16)19-13(20-14(8)21-6)7-3-4-9(17)11(18)10(7)15/h3-5H,2H2,1H3 |
| InChIKey | JETJJPXDWDPSNQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|