C14H20ClN3S — CID 82309139
4-chloro-6-ethyl-N,N-dipropylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 82309139) has the molecular formula C14H20ClN3S and a molecular weight of 297.86 g/mol. Its IUPAC name is 4-chloro-6-ethyl-N,N-dipropylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-ethyl-N,N-dipropylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 82309139 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-chloro-6-ethyl-N,N-dipropylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | CCCN(CCC)c1nc(Cl)c2cc(CC)sc2n1 |
| InChI | InChI=1S/C14H20ClN3S/c1-4-7-18(8-5-2)14-16-12(15)11-9-10(6-3)19-13(11)17-14/h9H,4-8H2,1-3H3 |
| InChIKey | FDGGYFANSRMJQQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |