C9H6BrF2N3S — CID 107541096
3-(2-bromo-3,4-difluorophenyl)-N-methyl-1,2,4-thiadiazol-5-amine (PubChem CID 107541096) has the molecular formula C9H6BrF2N3S and a molecular weight of 306.14 g/mol. Its IUPAC name is 3-(2-bromo-3,4-difluorophenyl)-N-methyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2-bromo-3,4-difluorophenyl)-N-methyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107541096 |
| Molecular Formula | C9H6BrF2N3S |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | 3-(2-bromo-3,4-difluorophenyl)-N-methyl-1,2,4-thiadiazol-5-amine |
| SMILES | CNc1nc(-c2ccc(F)c(F)c2Br)ns1 |
| InChI | InChI=1S/C9H6BrF2N3S/c1-13-9-14-8(15-16-9)4-2-3-5(11)7(12)6(4)10/h2-3H,1H3,(H,13,14,15) |
| InChIKey | XXXCJLKURDLMJL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|