C15H16BrF2N3 — CID 107540920
N-[[2-(2-bromo-3,4-difluorophenyl)pyrimidin-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 107540920) has the molecular formula C15H16BrF2N3 and a molecular weight of 356.21 g/mol. Its IUPAC name is N-[[2-(2-bromo-3,4-difluorophenyl)pyrimidin-5-yl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-(2-bromo-3,4-difluorophenyl)pyrimidin-5-yl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107540920 |
| Molecular Formula | C15H16BrF2N3 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-[[2-(2-bromo-3,4-difluorophenyl)pyrimidin-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cnc(-c2ccc(F)c(F)c2Br)nc1 |
| InChI | InChI=1S/C15H16BrF2N3/c1-15(2,3)21-8-9-6-19-14(20-7-9)10-4-5-11(17)13(18)12(10)16/h4-7,21H,8H2,1-3H3 |
| InChIKey | UEDBUYYJMQKKEA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|