C10H9BrFN3S — CID 107924739
3-(2-bromo-5-fluorophenyl)-N-ethyl-1,2,4-thiadiazol-5-amine (PubChem CID 107924739) has the molecular formula C10H9BrFN3S and a molecular weight of 302.17 g/mol. Its IUPAC name is 3-(2-bromo-5-fluorophenyl)-N-ethyl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2-bromo-5-fluorophenyl)-N-ethyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107924739 |
| Molecular Formula | C10H9BrFN3S |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 3-(2-bromo-5-fluorophenyl)-N-ethyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCNc1nc(-c2cc(F)ccc2Br)ns1 |
| InChI | InChI=1S/C10H9BrFN3S/c1-2-13-10-14-9(15-16-10)7-5-6(12)3-4-8(7)11/h3-5H,2H2,1H3,(H,13,14,15) |
| InChIKey | GTXPIPXYIKWQBV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |