C15H14BrF2N3 — CID 107539789
2-(2-bromo-3,4-difluorophenyl)-6-cyclopentylpyrimidin-4-amine (PubChem CID 107539789) has the molecular formula C15H14BrF2N3 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2-(2-bromo-3,4-difluorophenyl)-6-cyclopentylpyrimidin-4-amine.
| Compound Name | 2-(2-bromo-3,4-difluorophenyl)-6-cyclopentylpyrimidin-4-amine |
|---|---|
| PubChem CID | 107539789 |
| Molecular Formula | C15H14BrF2N3 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-(2-bromo-3,4-difluorophenyl)-6-cyclopentylpyrimidin-4-amine |
| SMILES | Nc1cc(C2CCCC2)nc(-c2ccc(F)c(F)c2Br)n1 |
| InChI | InChI=1S/C15H14BrF2N3/c16-13-9(5-6-10(17)14(13)18)15-20-11(7-12(19)21-15)8-3-1-2-4-8/h5-8H,1-4H2,(H2,19,20,21) |
| InChIKey | GKRXGNCPCGHODF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|