C14H11NO5 — CID 10923717
6-(2-methoxyphenyl)pyridine-2,3-dicarboxylic acid (PubChem CID 10923717) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 6-(2-methoxyphenyl)pyridine-2,3-dicarboxylic acid.
| Compound Name | 6-(2-methoxyphenyl)pyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 10923717 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 6-(2-methoxyphenyl)pyridine-2,3-dicarboxylic acid |
| SMILES | COc1ccccc1-c1ccc(C(=O)O)c(C(=O)O)n1 |
| InChI | InChI=1S/C14H11NO5/c1-20-11-5-3-2-4-8(11)10-7-6-9(13(16)17)12(15-10)14(18)19/h2-7H,1H3,(H,16,17)(H,18,19) |
| InChIKey | LDIFVOXQCHKTJE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |