C12H10N2O5 — CID 121001392
2-(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxylic acid (PubChem CID 121001392) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxylic acid.
| Compound Name | 2-(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 121001392 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-(2-methoxyphenyl)-1H-imidazole-4,5-dicarboxylic acid |
| SMILES | COc1ccccc1-c1nc(C(=O)O)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C12H10N2O5/c1-19-7-5-3-2-4-6(7)10-13-8(11(15)16)9(14-10)12(17)18/h2-5H,1H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | RUEOUVQDAWVOHH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |