C16H12N2O5 — CID 117252544
3-(2-methoxyphenyl)imidazo[1,5-a]pyridine-1,8-dicarboxylic acid (PubChem CID 117252544) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)imidazo[1,5-a]pyridine-1,8-dicarboxylic acid.
| Compound Name | 3-(2-methoxyphenyl)imidazo[1,5-a]pyridine-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 117252544 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-(2-methoxyphenyl)imidazo[1,5-a]pyridine-1,8-dicarboxylic acid |
| SMILES | COc1ccccc1-c1nc(C(=O)O)c2c(C(=O)O)cccn12 |
| InChI | InChI=1S/C16H12N2O5/c1-23-11-7-3-2-5-9(11)14-17-12(16(21)22)13-10(15(19)20)6-4-8-18(13)14/h2-8H,1H3,(H,19,20)(H,21,22) |
| InChIKey | XYXMFAVIKUAVMK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |