C13H12N2O5 — CID 54711736
5-hydroxy-2-(2-methoxyphenyl)-1-methyl-6-oxopyrimidine-4-carboxylic acid (PubChem CID 54711736) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-hydroxy-2-(2-methoxyphenyl)-1-methyl-6-oxopyrimidine-4-carboxylic acid.
| Compound Name | 5-hydroxy-2-(2-methoxyphenyl)-1-methyl-6-oxopyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 54711736 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-hydroxy-2-(2-methoxyphenyl)-1-methyl-6-oxopyrimidine-4-carboxylic acid |
| SMILES | COc1ccccc1-c1nc(C(=O)O)c(O)c(=O)n1C |
| InChI | InChI=1S/C13H12N2O5/c1-15-11(7-5-3-4-6-8(7)20-2)14-9(13(18)19)10(16)12(15)17/h3-6,16H,1-2H3,(H,18,19) |
| InChIKey | CFYWMMXPVWWAAY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |