C10H13ClN4O — CID 142787332
N-(5-chloropyrimidin-4-yl)piperidine-4-carboxamide (PubChem CID 142787332) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is N-(5-chloropyrimidin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-(5-chloropyrimidin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142787332 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N-(5-chloropyrimidin-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ncncc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C10H13ClN4O/c11-8-5-13-6-14-9(8)15-10(16)7-1-3-12-4-2-7/h5-7,12H,1-4H2,(H,13,14,15,16) |
| InChIKey | SXMSLPDCTABVGM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |