C27H33FN4O — CID 142789423
1-[3-(4-fluoroanilino)-2-(4-pentylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-2-methylpropan-1-one (PubChem CID 142789423) has the molecular formula C27H33FN4O and a molecular weight of 448.59 g/mol. Its IUPAC name is 1-[3-(4-fluoroanilino)-2-(4-pentylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-2-methylpropan-1-one.
| Compound Name | 1-[3-(4-fluoroanilino)-2-(4-pentylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 142789423 |
| Molecular Formula | C27H33FN4O |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 1-[3-(4-fluoroanilino)-2-(4-pentylphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-2-methylpropan-1-one |
| SMILES | CCCCCc1ccc(-c2nc3n(c2Nc2ccc(F)cc2)CCN(C(=O)C(C)C)C3)cc1 |
| InChI | InChI=1S/C27H33FN4O/c1-4-5-6-7-20-8-10-21(11-9-20)25-26(29-23-14-12-22(28)13-15-23)32-17-16-31(18-24(32)30-25)27(33)19(2)3/h8-15,19,29H,4-7,16-18H2,1-3H3 |
| InChIKey | UGHMIYWLNVFTBQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|