C23H27FN4 — CID 58179146
N-(4-fluorophenyl)-2-(4-pentylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-amine (PubChem CID 58179146) has the molecular formula C23H27FN4 and a molecular weight of 378.50 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(4-pentylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-amine.
| Compound Name | N-(4-fluorophenyl)-2-(4-pentylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-amine |
|---|---|
| PubChem CID | 58179146 |
| Molecular Formula | C23H27FN4 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-(4-fluorophenyl)-2-(4-pentylphenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-amine |
| SMILES | CCCCCc1ccc(-c2nc3n(c2Nc2ccc(F)cc2)CCNC3)cc1 |
| InChI | InChI=1S/C23H27FN4/c1-2-3-4-5-17-6-8-18(9-7-17)22-23(26-20-12-10-19(24)11-13-20)28-15-14-25-16-21(28)27-22/h6-13,25-26H,2-5,14-16H2,1H3 |
| InChIKey | SBFOHFWITUPNCF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|