C23H27N7O2 — CID 142790961
butyl 3-[[2-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)pyrimidin-4-yl]-methylamino]piperidine-1-carboxylate (PubChem CID 142790961) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is butyl 3-[[2-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)pyrimidin-4-yl]-methylamino]piperidine-1-carboxylate.
| Compound Name | butyl 3-[[2-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)pyrimidin-4-yl]-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142790961 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | butyl 3-[[2-(5-cyanopyrazolo[1,5-a]pyridin-3-yl)pyrimidin-4-yl]-methylamino]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCCC(N(C)c2ccnc(-c3cnn4ccc(C#N)cc34)n2)C1 |
| InChI | InChI=1S/C23H27N7O2/c1-3-4-12-32-23(31)29-10-5-6-18(16-29)28(2)21-7-9-25-22(27-21)19-15-26-30-11-8-17(14-24)13-20(19)30/h7-9,11,13,15,18H,3-6,10,12,16H2,1-2H3 |
| InChIKey | IRAMIYIMMYTWSW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|