C10H18F5NO2S — CID 142791538
3-(5,5,6,6,6-pentafluorohexylsulfonyl)butan-1-amine (PubChem CID 142791538) has the molecular formula C10H18F5NO2S and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-(5,5,6,6,6-pentafluorohexylsulfonyl)butan-1-amine.
| Compound Name | 3-(5,5,6,6,6-pentafluorohexylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 142791538 |
| Molecular Formula | C10H18F5NO2S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-(5,5,6,6,6-pentafluorohexylsulfonyl)butan-1-amine |
| SMILES | CC(CCN)S(=O)(=O)CCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H18F5NO2S/c1-8(4-6-16)19(17,18)7-3-2-5-9(11,12)10(13,14)15/h8H,2-7,16H2,1H3 |
| InChIKey | ZOSQCFJCMXRKIG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|