C26H32N4O — CID 142792605
2-[[1-(4-tert-butylphenyl)-2-pyridin-3-ylethyl]-(2-pyridin-4-ylethyl)amino]acetamide (PubChem CID 142792605) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[[1-(4-tert-butylphenyl)-2-pyridin-3-ylethyl]-(2-pyridin-4-ylethyl)amino]acetamide.
| Compound Name | 2-[[1-(4-tert-butylphenyl)-2-pyridin-3-ylethyl]-(2-pyridin-4-ylethyl)amino]acetamide |
|---|---|
| PubChem CID | 142792605 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 2-[[1-(4-tert-butylphenyl)-2-pyridin-3-ylethyl]-(2-pyridin-4-ylethyl)amino]acetamide |
| SMILES | CC(C)(C)c1ccc(C(Cc2cccnc2)N(CCc2ccncc2)CC(N)=O)cc1 |
| InChI | InChI=1S/C26H32N4O/c1-26(2,3)23-8-6-22(7-9-23)24(17-21-5-4-13-29-18-21)30(19-25(27)31)16-12-20-10-14-28-15-11-20/h4-11,13-15,18,24H,12,16-17,19H2,1-3H3,(H2,27,31) |
| InChIKey | OTGOROTYXSJIJO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |