C20H22N4OS — CID 142792696
2-[bis(2-pyridin-4-ylethyl)amino]-2-thiophen-3-ylacetamide (PubChem CID 142792696) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[bis(2-pyridin-4-ylethyl)amino]-2-thiophen-3-ylacetamide.
| Compound Name | 2-[bis(2-pyridin-4-ylethyl)amino]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 142792696 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[bis(2-pyridin-4-ylethyl)amino]-2-thiophen-3-ylacetamide |
| SMILES | NC(=O)C(c1ccsc1)N(CCc1ccncc1)CCc1ccncc1 |
| InChI | InChI=1S/C20H22N4OS/c21-20(25)19(18-7-14-26-15-18)24(12-5-16-1-8-22-9-2-16)13-6-17-3-10-23-11-4-17/h1-4,7-11,14-15,19H,5-6,12-13H2,(H2,21,25) |
| InChIKey | HHFGEHVNLUCGJJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |