C6H7F2N — CID 142793317
5-(2,2-difluoroethyl)-2H-pyrrole (PubChem CID 142793317) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is 5-(2,2-difluoroethyl)-2H-pyrrole.
| Compound Name | 5-(2,2-difluoroethyl)-2H-pyrrole |
|---|---|
| PubChem CID | 142793317 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 5-(2,2-difluoroethyl)-2H-pyrrole |
| SMILES | FC(F)CC1=NCC=C1 |
| InChI | InChI=1S/C6H7F2N/c7-6(8)4-5-2-1-3-9-5/h1-2,6H,3-4H2 |
| InChIKey | IMGQOBPZJBNUIV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |