C27H23ClF2N4O2 — CID 142793687
2-(6-chloro-3-pyridinyl)-2-[5-fluoro-2-[1-(4-fluorophenyl)ethylamino]-4-(6-methoxy-3-pyridinyl)phenyl]acetamide (PubChem CID 142793687) has the molecular formula C27H23ClF2N4O2 and a molecular weight of 508.96 g/mol. Its IUPAC name is 2-(6-chloro-3-pyridinyl)-2-[5-fluoro-2-[1-(4-fluorophenyl)ethylamino]-4-(6-methoxy-3-pyridinyl)phenyl]acetamide.
| Compound Name | 2-(6-chloro-3-pyridinyl)-2-[5-fluoro-2-[1-(4-fluorophenyl)ethylamino]-4-(6-methoxy-3-pyridinyl)phenyl]acetamide |
|---|---|
| PubChem CID | 142793687 |
| Molecular Formula | C27H23ClF2N4O2 |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-(6-chloro-3-pyridinyl)-2-[5-fluoro-2-[1-(4-fluorophenyl)ethylamino]-4-(6-methoxy-3-pyridinyl)phenyl]acetamide |
| SMILES | COc1ccc(-c2cc(NC(C)c3ccc(F)cc3)c(C(C(N)=O)c3ccc(Cl)nc3)cc2F)cn1 |
| InChI | InChI=1S/C27H23ClF2N4O2/c1-15(16-3-7-19(29)8-4-16)34-23-12-20(17-6-10-25(36-2)33-13-17)22(30)11-21(23)26(27(31)35)18-5-9-24(28)32-14-18/h3-15,26,34H,1-2H3,(H2,31,35) |
| InChIKey | JUDDSXBTZDUTBN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|