C12H17BFN3O5 — CID 142793898
[2-(4-ethoxycarbonyl-4-fluoropiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid (PubChem CID 142793898) has the molecular formula C12H17BFN3O5 and a molecular weight of 313.09 g/mol. Its IUPAC name is [2-(4-ethoxycarbonyl-4-fluoropiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid.
| Compound Name | [2-(4-ethoxycarbonyl-4-fluoropiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid |
|---|---|
| PubChem CID | 142793898 |
| Molecular Formula | C12H17BFN3O5 |
| Molecular Weight | 313.09 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [2-(4-ethoxycarbonyl-4-fluoropiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid |
| SMILES | CCOC(=O)C1(F)CCN(c2ncc(OB(O)O)cn2)CC1 |
| InChI | InChI=1S/C12H17BFN3O5/c1-2-21-10(18)12(14)3-5-17(6-4-12)11-15-7-9(8-16-11)22-13(19)20/h7-8,19-20H,2-6H2,1H3 |
| InChIKey | BLRHZBFMCIZPHD-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.09 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|