About 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine
4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine (PubChem CID 142794129) has the molecular formula C20H29N3O
and a molecular weight of 327.47 g/mol. Its IUPAC name is 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine.
Molecular Properties
| Compound Name | 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine |
| PubChem CID | 142794129 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine |
| SMILES | CC1(C)CCCC1N1CCC(c2ccc(N3CCOCC3)cc2)=N1 |
| InChI | InChI=1S/C20H29N3O/c1-20(2)10-3-4-19(20)23-11-9-18(21-23)16-5-7-17(8-6-16)22-12-14-24-15-13-22/h5-8,19H,3-4,9-15H2,1-2H3 |
| InChIKey | GLPWRSGBXZGLKG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine?
The IUPAC name of 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine (CID 142794129) is 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine.
What is the SMILES notation for 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine?
The canonical SMILES for 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine is CC1(C)CCCC1N1CCC(c2ccc(N3CCOCC3)cc2)=N1.
What is the InChIKey of 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine?
The InChIKey is GLPWRSGBXZGLKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O/c1-20(2)10-3-4-19(20)23-11-9-18(21-23)16-5-7-17(8-6-16)22-12-14-24-15-13-22/h5-8,19H,3-4,9-15H2,1-2H3.
What are the key properties of 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine?
4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine has a molecular weight of 327.47 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(2,2-dimethylcyclopentyl)-3,4-dihydropyrazol-5-yl]phenyl]morpholine is sourced from PubChem (CID 142794129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).