C17H29N3OS — CID 142795811
2-[ethyl-[4-[ethyl(methyl)amino]cyclohexyl]amino]-4-methylthiophene-3-carboxamide (PubChem CID 142795811) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is 2-[ethyl-[4-[ethyl(methyl)amino]cyclohexyl]amino]-4-methylthiophene-3-carboxamide.
| Compound Name | 2-[ethyl-[4-[ethyl(methyl)amino]cyclohexyl]amino]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 142795811 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-[ethyl-[4-[ethyl(methyl)amino]cyclohexyl]amino]-4-methylthiophene-3-carboxamide |
| SMILES | CCN(C)C1CCC(N(CC)c2scc(C)c2C(N)=O)CC1 |
| InChI | InChI=1S/C17H29N3OS/c1-5-19(4)13-7-9-14(10-8-13)20(6-2)17-15(16(18)21)12(3)11-22-17/h11,13-14H,5-10H2,1-4H3,(H2,18,21) |
| InChIKey | WKIRPGNRXVVASX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |