C11H18F3N3 — CID 142797788
5-octan-3-yl-3-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 142797788) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is 5-octan-3-yl-3-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 5-octan-3-yl-3-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 142797788 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 5-octan-3-yl-3-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | CCCCCC(CC)c1nc(C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C11H18F3N3/c1-3-5-6-7-8(4-2)9-15-10(17-16-9)11(12,13)14/h8H,3-7H2,1-2H3,(H,15,16,17) |
| InChIKey | KPJMFYNBRFUVPJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|