C11H19F2N3 — CID 57058217
3-(1,1-difluorobutyl)-5-pentyl-1H-1,2,4-triazole (PubChem CID 57058217) has the molecular formula C11H19F2N3 and a molecular weight of 231.29 g/mol. Its IUPAC name is 3-(1,1-difluorobutyl)-5-pentyl-1H-1,2,4-triazole.
| Compound Name | 3-(1,1-difluorobutyl)-5-pentyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 57058217 |
| Molecular Formula | C11H19F2N3 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-(1,1-difluorobutyl)-5-pentyl-1H-1,2,4-triazole |
| SMILES | CCCCCc1nc(C(F)(F)CCC)n[nH]1 |
| InChI | InChI=1S/C11H19F2N3/c1-3-5-6-7-9-14-10(16-15-9)11(12,13)8-4-2/h3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | MYTCRLNDDRZJNC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|