C14H18ClNO2 — CID 142798968
2-(4-chlorophenyl)-2-(4-hydroxycyclohexyl)acetamide (PubChem CID 142798968) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(4-hydroxycyclohexyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-2-(4-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 142798968 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(4-hydroxycyclohexyl)acetamide |
| SMILES | NC(=O)C(c1ccc(Cl)cc1)C1CCC(O)CC1 |
| InChI | InChI=1S/C14H18ClNO2/c15-11-5-1-9(2-6-11)13(14(16)18)10-3-7-12(17)8-4-10/h1-2,5-6,10,12-13,17H,3-4,7-8H2,(H2,16,18) |
| InChIKey | XXFYTEUPAUPGTQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |