C12H18BN3O5 — CID 142799088
[2-(4-methoxycarbonyl-4-methylpiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid (PubChem CID 142799088) has the molecular formula C12H18BN3O5 and a molecular weight of 295.10 g/mol. Its IUPAC name is [2-(4-methoxycarbonyl-4-methylpiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid.
| Compound Name | [2-(4-methoxycarbonyl-4-methylpiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid |
|---|---|
| PubChem CID | 142799088 |
| Molecular Formula | C12H18BN3O5 |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | [2-(4-methoxycarbonyl-4-methylpiperidin-1-yl)pyrimidin-5-yl]oxyboronic acid |
| SMILES | COC(=O)C1(C)CCN(c2ncc(OB(O)O)cn2)CC1 |
| InChI | InChI=1S/C12H18BN3O5/c1-12(10(17)20-2)3-5-16(6-4-12)11-14-7-9(8-15-11)21-13(18)19/h7-8,18-19H,3-6H2,1-2H3 |
| InChIKey | YKROHXWDSZSQED-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 105.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|