C18H16N4O — CID 142800173
4-[2-[2-(3-methoxyphenyl)ethyl]-1,2,4-triazol-3-yl]benzonitrile (PubChem CID 142800173) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-[2-[2-(3-methoxyphenyl)ethyl]-1,2,4-triazol-3-yl]benzonitrile.
| Compound Name | 4-[2-[2-(3-methoxyphenyl)ethyl]-1,2,4-triazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 142800173 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[2-[2-(3-methoxyphenyl)ethyl]-1,2,4-triazol-3-yl]benzonitrile |
| SMILES | COc1cccc(CCn2ncnc2-c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C18H16N4O/c1-23-17-4-2-3-14(11-17)9-10-22-18(20-13-21-22)16-7-5-15(12-19)6-8-16/h2-8,11,13H,9-10H2,1H3 |
| InChIKey | DFOQRDRRVNHMLQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |