C19H21N3O — CID 67950604
5-(4-butylphenyl)-1-(3-methoxyphenyl)-1,2,4-triazole (PubChem CID 67950604) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 5-(4-butylphenyl)-1-(3-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 5-(4-butylphenyl)-1-(3-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 67950604 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 5-(4-butylphenyl)-1-(3-methoxyphenyl)-1,2,4-triazole |
| SMILES | CCCCc1ccc(-c2ncnn2-c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-3-4-6-15-9-11-16(12-10-15)19-20-14-21-22(19)17-7-5-8-18(13-17)23-2/h5,7-14H,3-4,6H2,1-2H3 |
| InChIKey | JNLJWAIZTFEHOT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |