C58H56N4O2 — CID 59412031
9-[3-[4-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]phenyl]propyl]-3-(3-heptoxyphenyl)-6-(3-methoxyphenyl)carbazole (PubChem CID 59412031) has the molecular formula C58H56N4O2 and a molecular weight of 841.11 g/mol. Its IUPAC name is 9-[3-[4-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]phenyl]propyl]-3-(3-heptoxyphenyl)-6-(3-methoxyphenyl)carbazole.
| Compound Name | 9-[3-[4-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]phenyl]propyl]-3-(3-heptoxyphenyl)-6-(3-methoxyphenyl)carbazole |
|---|---|
| PubChem CID | 59412031 |
| Molecular Formula | C58H56N4O2 |
| Molecular Weight | 841.11 g/mol |
| Exact Mass | 840.44 |
| IUPAC Name | 9-[3-[4-[4,6-bis(3-methylphenyl)-1,3,5-triazin-2-yl]phenyl]propyl]-3-(3-heptoxyphenyl)-6-(3-methoxyphenyl)carbazole |
| SMILES | CCCCCCCOc1cccc(-c2ccc3c(c2)c2cc(-c4cccc(OC)c4)ccc2n3CCCc2ccc(-c3nc(-c4cccc(C)c4)nc(-c4cccc(C)c4)n3)cc2)c1 |
| InChI | InChI=1S/C58H56N4O2/c1-5-6-7-8-9-33-64-51-23-13-19-45(37-51)47-29-31-55-53(39-47)52-38-46(44-18-12-22-50(36-44)63-4)28-30-54(52)62(55)32-14-17-42-24-26-43(27-25-42)56-59-57(48-20-10-15-40(2)34-48)61-58(60-56)49-21-11-16-41(3)35-49/h10-13,15-16,18-31,34-39H,5-9,14,17,32-33H2,1-4H3 |
| InChIKey | ZYWWSLKEGCINHI-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.11 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|