3-ethoxypyridine-2-carbonyl chloride

C8H8ClNO2 — CID 142800977

IUPAC3-ethoxypyridine-2-carbonyl chloride
SMILESCCOc1cccnc1C(=O)Cl
InChIInChI=1S/C8H8ClNO2/c1-2-12-6-4-3-5-10-7(6)8(9)11/h3-5H,2H2,1H3
InChIKeyDSVFMYUOKNCENN-UHFFFAOYSA-N
MW185.61 g/mol
LogP1.86
Rot. Bonds3

About 3-ethoxypyridine-2-carbonyl chloride

3-ethoxypyridine-2-carbonyl chloride (PubChem CID 142800977) has the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. Its IUPAC name is 3-ethoxypyridine-2-carbonyl chloride.

Molecular Properties

Compound Name3-ethoxypyridine-2-carbonyl chloride
PubChem CID142800977
Molecular FormulaC8H8ClNO2
Molecular Weight185.61 g/mol
Exact Mass185.02
IUPAC Name3-ethoxypyridine-2-carbonyl chloride
SMILESCCOc1cccnc1C(=O)Cl
InChIInChI=1S/C8H8ClNO2/c1-2-12-6-4-3-5-10-7(6)8(9)11/h3-5H,2H2,1H3
InChIKeyDSVFMYUOKNCENN-UHFFFAOYSA-N
XLogP1.86
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.61
LogP ≤ 51.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-ethoxypyridine-2-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethoxypyridine-2-carbonyl chloride?
The IUPAC name of 3-ethoxypyridine-2-carbonyl chloride (CID 142800977) is 3-ethoxypyridine-2-carbonyl chloride.
What is the SMILES notation for 3-ethoxypyridine-2-carbonyl chloride?
The canonical SMILES for 3-ethoxypyridine-2-carbonyl chloride is CCOc1cccnc1C(=O)Cl.
What is the InChIKey of 3-ethoxypyridine-2-carbonyl chloride?
The InChIKey is DSVFMYUOKNCENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO2/c1-2-12-6-4-3-5-10-7(6)8(9)11/h3-5H,2H2,1H3.
What are the key properties of 3-ethoxypyridine-2-carbonyl chloride?
3-ethoxypyridine-2-carbonyl chloride has a molecular weight of 185.61 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxypyridine-2-carbonyl chloride is sourced from PubChem (CID 142800977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).