C24H34F3NO3 — CID 142801075
[[(1R,3S)-1-amino-3-[(6S)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]-hydroxymethyl] 2,2,2-trifluoroacetate (PubChem CID 142801075) has the molecular formula C24H34F3NO3 and a molecular weight of 441.53 g/mol. Its IUPAC name is [[(1R,3S)-1-amino-3-[(6S)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]-hydroxymethyl] 2,2,2-trifluoroacetate.
| Compound Name | [[(1R,3S)-1-amino-3-[(6S)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]-hydroxymethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 142801075 |
| Molecular Formula | C24H34F3NO3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | [[(1R,3S)-1-amino-3-[(6S)-6-hexyl-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]-hydroxymethyl] 2,2,2-trifluoroacetate |
| SMILES | CCCCCC[C@H]1CCc2cc([C@H]3CC[C@](N)(C(O)OC(=O)C(F)(F)F)C3)ccc2C1 |
| InChI | InChI=1S/C24H34F3NO3/c1-2-3-4-5-6-16-7-8-18-14-19(10-9-17(18)13-16)20-11-12-23(28,15-20)21(29)31-22(30)24(25,26)27/h9-10,14,16,20-21,29H,2-8,11-13,15,28H2,1H3/t16-,20-,21?,23+/m0/s1 |
| InChIKey | NXYNNMIRNNYLQH-BWLIKDKNSA-N |
| XLogP | 5.15 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|