C22H34O — CID 145021568
[(1S,3S)-1-methyl-3-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopentyl]methanol (PubChem CID 145021568) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is [(1S,3S)-1-methyl-3-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopentyl]methanol.
| Compound Name | [(1S,3S)-1-methyl-3-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopentyl]methanol |
|---|---|
| PubChem CID | 145021568 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | [(1S,3S)-1-methyl-3-(6-pentyl-5,6,7,8-tetrahydronaphthalen-2-yl)cyclopentyl]methanol |
| SMILES | CCCCCC1CCc2cc([C@H]3CC[C@](C)(CO)C3)ccc2C1 |
| InChI | InChI=1S/C22H34O/c1-3-4-5-6-17-7-8-19-14-20(10-9-18(19)13-17)21-11-12-22(2,15-21)16-23/h9-10,14,17,21,23H,3-8,11-13,15-16H2,1-2H3/t17?,21-,22-/m0/s1 |
| InChIKey | BQIASMKARCVLNP-VNQANMTISA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|