C9H8N2OS2 — CID 142801611
2-ethylsulfanylthieno[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 142801611) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-ethylsulfanylthieno[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 2-ethylsulfanylthieno[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 142801611 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-ethylsulfanylthieno[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | CCSc1ncc2cc(C=O)sc2n1 |
| InChI | InChI=1S/C9H8N2OS2/c1-2-13-9-10-4-6-3-7(5-12)14-8(6)11-9/h3-5H,2H2,1H3 |
| InChIKey | CCCQEZZLVSMHRF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|