About chloromethanesulfinamide
chloromethanesulfinamide (PubChem CID 142801785) has the molecular formula CH4ClNOS
and a molecular weight of 113.57 g/mol. Its IUPAC name is chloromethanesulfinamide.
Molecular Properties
| Compound Name | chloromethanesulfinamide |
| PubChem CID | 142801785 |
| Molecular Formula | CH4ClNOS |
| Molecular Weight | 113.57 g/mol |
| Exact Mass | 112.97 |
| IUPAC Name | chloromethanesulfinamide |
| SMILES | NS(=O)CCl |
| InChI | InChI=1S/CH4ClNOS/c2-1-5(3)4/h1,3H2 |
| InChIKey | PQNCXGAUGHQEED-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.57 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethanesulfinamide?
The IUPAC name of chloromethanesulfinamide (CID 142801785) is chloromethanesulfinamide.
What is the SMILES notation for chloromethanesulfinamide?
The canonical SMILES for chloromethanesulfinamide is NS(=O)CCl.
What is the InChIKey of chloromethanesulfinamide?
The InChIKey is PQNCXGAUGHQEED-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4ClNOS/c2-1-5(3)4/h1,3H2.
What are the key properties of chloromethanesulfinamide?
chloromethanesulfinamide has a molecular weight of 113.57 g/mol, XLogP of -0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethanesulfinamide is sourced from PubChem (CID 142801785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).