About ethanesulfinamide;hydrochloride
ethanesulfinamide;hydrochloride (PubChem CID 155487048) has the molecular formula C2H8ClNOS
and a molecular weight of 129.61 g/mol. Its IUPAC name is ethanesulfinamide;hydrochloride.
Molecular Properties
| Compound Name | ethanesulfinamide;hydrochloride |
| PubChem CID | 155487048 |
| Molecular Formula | C2H8ClNOS |
| Molecular Weight | 129.61 g/mol |
| Exact Mass | 129.00 |
| IUPAC Name | ethanesulfinamide;hydrochloride |
| SMILES | CCS(N)=O.Cl |
| InChI | InChI=1S/C2H7NOS.ClH/c1-2-5(3)4;/h2-3H2,1H3;1H |
| InChIKey | SCVUTLCSIWSMFO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.61 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethanesulfinamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanesulfinamide;hydrochloride?
The IUPAC name of ethanesulfinamide;hydrochloride (CID 155487048) is ethanesulfinamide;hydrochloride.
What is the SMILES notation for ethanesulfinamide;hydrochloride?
The canonical SMILES for ethanesulfinamide;hydrochloride is CCS(N)=O.Cl.
What is the InChIKey of ethanesulfinamide;hydrochloride?
The InChIKey is SCVUTLCSIWSMFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NOS.ClH/c1-2-5(3)4;/h2-3H2,1H3;1H.
What are the key properties of ethanesulfinamide;hydrochloride?
ethanesulfinamide;hydrochloride has a molecular weight of 129.61 g/mol, XLogP of 0.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethanesulfinamide;hydrochloride is sourced from PubChem (CID 155487048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).