About ethyl-methylidyne-oxo-λ6-sulfane
ethyl-methylidyne-oxo-λ6-sulfane (PubChem CID 145181210) has the molecular formula C3H6OS
and a molecular weight of 90.15 g/mol. Its IUPAC name is ethyl-methylidyne-oxo-λ6-sulfane.
Molecular Properties
| Compound Name | ethyl-methylidyne-oxo-λ6-sulfane |
| PubChem CID | 145181210 |
| Molecular Formula | C3H6OS |
| Molecular Weight | 90.15 g/mol |
| Exact Mass | 90.01 |
| IUPAC Name | ethyl-methylidyne-oxo-λ6-sulfane |
| SMILES | C#S(=O)CC |
| InChI | InChI=1S/C3H6OS/c1-3-5(2)4/h2H,3H2,1H3 |
| InChIKey | LADJUAGRCUCPNO-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.15 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethyl-methylidyne-oxo-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-methylidyne-oxo-λ6-sulfane?
The IUPAC name of ethyl-methylidyne-oxo-λ6-sulfane (CID 145181210) is ethyl-methylidyne-oxo-λ6-sulfane.
What is the SMILES notation for ethyl-methylidyne-oxo-λ6-sulfane?
The canonical SMILES for ethyl-methylidyne-oxo-λ6-sulfane is C#S(=O)CC.
What is the InChIKey of ethyl-methylidyne-oxo-λ6-sulfane?
The InChIKey is LADJUAGRCUCPNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6OS/c1-3-5(2)4/h2H,3H2,1H3.
What are the key properties of ethyl-methylidyne-oxo-λ6-sulfane?
ethyl-methylidyne-oxo-λ6-sulfane has a molecular weight of 90.15 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-methylidyne-oxo-λ6-sulfane is sourced from PubChem (CID 145181210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).