About ethane;2-ethylsulfinylpropane
ethane;2-ethylsulfinylpropane (PubChem CID 90763779) has the molecular formula C7H18OS
and a molecular weight of 150.29 g/mol. Its IUPAC name is ethane;2-ethylsulfinylpropane.
Molecular Properties
| Compound Name | ethane;2-ethylsulfinylpropane |
| PubChem CID | 90763779 |
| Molecular Formula | C7H18OS |
| Molecular Weight | 150.29 g/mol |
| Exact Mass | 150.11 |
| IUPAC Name | ethane;2-ethylsulfinylpropane |
| SMILES | CC.CCS(=O)C(C)C |
| InChI | InChI=1S/C5H12OS.C2H6/c1-4-7(6)5(2)3;1-2/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | CUBYEGBTDCYVLY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-ethylsulfinylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethylsulfinylpropane?
The IUPAC name of ethane;2-ethylsulfinylpropane (CID 90763779) is ethane;2-ethylsulfinylpropane.
What is the SMILES notation for ethane;2-ethylsulfinylpropane?
The canonical SMILES for ethane;2-ethylsulfinylpropane is CC.CCS(=O)C(C)C.
What is the InChIKey of ethane;2-ethylsulfinylpropane?
The InChIKey is CUBYEGBTDCYVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12OS.C2H6/c1-4-7(6)5(2)3;1-2/h5H,4H2,1-3H3;1-2H3.
What are the key properties of ethane;2-ethylsulfinylpropane?
ethane;2-ethylsulfinylpropane has a molecular weight of 150.29 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethylsulfinylpropane is sourced from PubChem (CID 90763779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).